Albuterol D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02813 |
| Alternative Name(s) | Salbutamol-D3;(±)-Albuterol D3; |
| Research Area | Labeled Albuterol, intended for use as an internal standard for the quantification of Albuterol by GC- or LC-mass spectrometry. |
| Molecular Formula | C13H18NO3D3 |
| CAS# | 1219798-60-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC(C([2H])([2H])O)=C(O)C=C1)([2H])CNC(C)(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02813.html |
| Additional Information | NULL |