Nisoldipine D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02771 |
| Alternative Name(s) | 3-methyl 5-(2-methylpropyl) 2,6-dimethyl-4-[2-nitro(²H4)phenyl]-1,4-dihydropyridine-3,5-dicarboxylate;Bay k 5552-d4; Baymycard-d4; Norvasc-d4; Syscor-d4; Zadipina-d4; 1,4-Dihydro-2,6-dimethyl-4-(2-nitrophenyl-d4)-3,5-pyridinedicarboxylic Acid Methyl 2-Methylpropyl Ester |
| Research Area | Nisoldipine-d4 is the labeled analogue of Nisoldipine , a dihydropyridine calcium channel blocker. Antihypertensive and antianginal.;Labeled Nisoldipine, intended for use as an internal standard for the quantification of Nisoldipine by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 1219795-47-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[N](=O)=O)C(C(OC)=O)=C(C)N2)=C2C)OCC(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02771.html |
| Additional Information | NULL |