Aurothioglucose
Aurothioglucose is a well known active-site inhibitor of TrxR1, inhibited TrxR1 activity in HeLa cell cytosol but had no effect on the viability of the cells.
| Trivial name | Solganal |
| Catalog Number | CSN16891 |
| Alternative Name(s) | Solganal |
| Research Area | Cancer |
| Molecular Formula | C6H11AuO5S |
| CAS# | 12192-57-3 |
| Purity | ≥98% |
| SMILES | O[C@@H]1[C@](O[Au+][SH-]2)([H])C2O[C@H](CO)[C@H]1O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/aurothioglucose.html |