Dorsomorphin 2HCl 10mM * 1mL in DMSO
Dorsomorphin, also known as BML-275, is a selective small molecule inhibitor of BMP signaling, which promotes cardiomyogenesis in embryonic stem cells. Dorsomorphin reverses the mesenchymal phenotype of breast cancer initiating cells by inhibition of bone morphogenetic protein signaling.
| Trivial name | Dorsomorphin 2HCl 10mM * 1mL in DMSO |
| Catalog Number | A13720-10mM-D |
| Alternative Name(s) | 6-(4-(2-(piperidin-1-yl)ethoxy)phenyl)-3-(pyridin-4-yl)pyrazolo[1,5-a]pyrimidine dihydrochloride. |
| Molecular Formula | C24H27Cl2N5O |
| CAS# | 1219168-18-9 |
| SMILES | C1CCN(CC1)CCOC2=CC=C(C=C2)C3=CN4C(=C(C=N4)C5=CC=NC=C5)N=C3.Cl.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dorsomorphin-2hcl.html |
