CAY10505 50mg
CAY10505 is a potent inhibitor of PI3K, selectively inhibiting the γ isoform (IC50 = 30 nM) better than the α, β, and δ isoforms (IC50 = 0.94, 20, and 20 μM, respectively).
Trivial name | CAY10505 50mg |
Catalog Number | A11196-50 |
Alternative Name(s) | 5-?€?[[5-?€?(4-?€?fluorophenyl)-?€?2-?€?furanyl]methylene]-?€?2,?€?4-?€?thiazolidinedione |
Molecular Formula | C14H8FNO3S |
CAS# | 1218777-13-9 |
SMILES | C1=CC(=CC=C1C2=CC=C(O2)/C=C/3C(=O)NC(=O)S3)F |
Size | 50mg |
Supplier Page | http://www.adooq.com/cay10505.html |