Deferasirox Benzoxazin Impurity
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-07766 |
| Alternative Name(s) | 2-(2-hydroxyphenyl)-4H-benzo[e][1,3]oxazin-4-one; Deferasirox Impurity B; 2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one; -(o-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one |
| Research Area | Intermediate in the production of Deferasirox. |
| Molecular Formula | C14H9NO3 |
| CAS# | 1218-69-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C=CC=C1)=C1C(OC2=CC=CC=C23)=NC3=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO07766.html |
| Additional Information | NULL |
