Ketoconazole D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-AP-00028 |
| Alternative Name(s) | 1-[4-(4-{[(2R,4S)-2-(2,4-dichlorophenyl)-2-(1H- imidazol-1-ylmethyl)-1,3-dioxolan-4- yl]methoxy}phenyl)(2H8)piperazin-1-yl]ethan-1-one |
| Research Area | Labeled Ketoconazole , intended for use as an internal standard for the quantification of Ketoconazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C26H20D8Cl2N4O4 |
| CAS# | 1217706-96-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(C=CC(Cl)=C1)[C@@]2(O[C@@H](COC3=CC=C(N4C([2H])([2H])C([2H])([2H])N(C(C)=O)C([2H])([2H])C4([2H])[2H])C=C3)CO2)CN5C=CN=C5 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSAP00028.html |
| Additional Information | NULL |