Tiagabine D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02736 |
| Alternative Name(s) | (3R)-1-{4,4-bis[3-(D3)methylthiophen-2-yl]but-3- en-1-yl}piperidine-3-carboxylic acid |
| Research Area | Labeled Tiagabine, intended for use as an internal standard for the quantification of Tiagabine by GC- or LC-mass spectrometry. |
| Molecular Formula | C20H19D6NO2S2 |
| CAS# | 1217672-34-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([C@H]1CN(CCC1)CC/C=C(C(SC=C2)=C2C([2H])([2H])[2H])/C(SC=C3)=C3C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02736.html |
| Additional Information | NULL |