Tolterodine D14 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03027 |
| Alternative Name(s) | 2-[(1S)-3-{bis[(²H7)propan-2-yl]amino}-1- phenylpropyl]-4-methylphenol hydrchloride |
| Research Area | Labeled Tolterodine, intended for use as an internal standard for the quantification of Tolterodine by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H18D14ClNO |
| CAS# | 1217645-16-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1=C(C=C(C)C=C1)[C@@H](C2=CC=CC=C2)CCN(C(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])C(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H].Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03027.html |
| Additional Information | NULL |