Itraconazole D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06691 |
| Alternative Name(s) | (+/-)-4-[4-[4-[4-[[(2R,4S)-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1-piperazinyl]phenyl]-2,4-dihydro-2-(1-methyl-d3-propyl)-3H-1,2,4-triazol-3-one; Itrizole-d3; Oriconazole-d3; R-51211-d3; Sporamelt-d3; Sporanox-d3; Triasporin-d3; |
| Research Area | Labeled Itraconazole, intended for use as an internal standard for the quantification of Itraconazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C35H35D3Cl2N8O4 |
| CAS# | 1217512-35-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(C=CC(Cl)=C1)[C@@]2(O[C@@H](COC3=CC=C(N4CCN(C5=CC=C(N(C=NN6C(C([2H])([2H])[2H])CC)C6=O)C=C5)CC4)C=C3)CO2)CN7C=NC=N7 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06691.html |
| Additional Information | NULL |