(+)-UH 232 maleate
(+)-UH 232 maleate is a dopamine D2 antagonist (Ki = 72.7 nM in a ligand binding assay; apparent KB = 14.5 nM in a cAMP accumulation assay) that preferentially effects on central dopamine autoreceptors. (+)-UH 232 maleate significantly promotes dopamine synthesis and turnover. (+)-UH 232 maleate is also a dopamine D3 partial agonist.
| Catalog Number | 1217473-50-1 |
| Alternative Name(s) | cis-(+)-5-Methoxy-1-methyl-2-(di-N-propylamino)tetralin maleate; SR-01000597860 |
| Molecular Formula | C18H29NO.C4H4O4 |
| CAS# | 1217473-50-1 |
| Inchi | InChI=1S/C18H29NO.C4H4O4/c1-5-12-19(13-6-2)17-11-10-16-15(14(17)3)8-7-9-18(16)20-4;5-3(6)1-2-4(7)8/h7-9,14,17H,5-6,10-13H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,17+;/m0./s1 |
| Inchi Key | MEQAJDYHKYAPJE-GUUGRXDUSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/uh-232-maleate-cas-1217473-50-1-item-170521.html |
