CP 31398 dihydrochloride 50mg
CP 31398 dihydrochloride, p53 stabilizing agent. Stabilizes the active conformation of p53 and promotes p53 activity in cancer cell lines with mutant or wild-type p53. Inhibits growth of small human tumor xenografts in vivo.
| Trivial name | CP 31398 dihydrochloride 50mg |
| Catalog Number | A15346-50 |
| Alternative Name(s) | (E)-N1-(2-(4-methoxystyryl)quinazolin-4-yl)-N3,N3-dimethylpropane-1,3-diamine dihydrochloride |
| Molecular Formula | C22H26N4O |
| CAS# | 1217195-61-3 |
| SMILES | Cl.Cl.O(C3=CC=C(C=CC2=NC1=CC=CC=C1C(=N2)NCCCN(C)C)C=C3)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/cp-31398-dihydrochloride.html |
