Hydroxy Bupropion D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02798 |
| Alternative Name(s) | Bupropion Morpholinol D6;2-((1-hydroxy-2-methylpropan d6-2-yl)amino)-1-phenylpropan-1-one; |
| Research Area | Labeled Metabolite of Bupropion, intended for use as an internal standard for the quantification of Bupropion by GC- or LC-mass spectrometry. |
| Molecular Formula | C13H12DClNO2 |
| CAS# | 1216893-18-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(OCC(C([2H])([2H])[2H])(C([2H])([2H])[2H])N1)(C2=CC(Cl)=CC=C2)C1C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02798.html |
| Additional Information | NULL |