ZK 93426 hydrochloride
ZK 93426 hydrochloride is a potent, selective and competitive benzodiazepine receptor antagonist (IC50 = 0.4 and 0.7 nM for inhibition of [3H]-flunitrazepam binding to rat cerebellum and hippocampus, respectively). ZK 93426 hydrochloride displays both anxiogenic and anxiolytic effects.
| Catalog Number | 1216792-30-1 |
| Alternative Name(s) | ZK 93426 hydrochloride; ZK93426 hydrochloride; ZK-93426 hydrochloride; 4-Methyl-5-(1-methylethoxy)-9H-pyrido[3,4-b]indole-3-carboxylic acid ethyl ester hydrochloride |
| Molecular Formula | C18H20N2O3.HCl |
| CAS# | 1216792-30-1 |
| Purity | ≥99% |
| Inchi | InChI=1S/C18H20N2O3.ClH/c1-5-22-18(21)17-11(4)15-13(9-19-17)20-12-7-6-8-14(16(12)15)23-10(2)3;/h6-10,20H,5H2,1-4H3;1H |
| Inchi Key | RNQJDOYVHCISJU-UHFFFAOYSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/zk-93426-hydrochloride-cas-1216792-30-1-item-170447.html |