Tinidazole D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02906 |
| Alternative Name(s) | 1-[2-(Ethyl-d5-sulfonyl)ethyl]-2-methyl-5-nitro-1H-imidazole; Bioshik-dl-5-nitroimidazol-1-yl)ethyl] sulfone; Fasigin-d5; Fasigyn-d5; Glongyn-d5; Pletil-d5; Simplotan-d5; Sorquetan-d5; Tindamax-d5; Tini 300-d5 |
| Research Area | Labelled Tinidazole. Antiprotozoal (Trichomonas, Giardia); antiamebic; antibacterial.;Labeled Tinidazole, intended for use as an internal standard for the quantification of Tinidazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H8D5N3O4S |
| CAS# | 1216767-04-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](CCN1C([N](=O)=O)=CN=C1C)(C([2H])([2H])C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02906.html |
| Additional Information | NULL |