APY29
IRE1α inhibitor
| Catalog Number | B3288-50 |
| Molecular Formula | C17H16N8 |
| CAS# | 1216665-49-4 |
| Purity | 98.05% |
| SMILES | C1(C2=CC(/N=C(N3)C=CN=C3NC4=CC5=C(N=CN5)C=C4)=NN2)CC1 |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3288 |
