Ibuprofen D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10055 |
| Alternative Name(s) | rac Ibuprofen-d3;2-(4-Isobutylphenyl)propionic Acid-d3;α-Methyl-d3-4-(isobutyl)phenylacetic acid;CS-O-03151 |
| Research Area | Labeled Ibuprofen, intended for use as an internal standard for the quantification of Ibuprofen by GC- or LC-mass spectrometry. |
| Molecular Formula | C13H15D3O2 |
| CAS# | 121662-14-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(C1=CC=C(CC(C)C)C=C1)C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10055.html |
| Additional Information | NULL |