Carisoprodol D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06465 |
| Alternative Name(s) | 2-(D3)methyl-2-({[(propan-2- ate |
| Research Area | Labeled Carisoprodol, intended for use as an internal standard for the quantification of Carisoprodol by GC- or LC-mass spectrometry. |
| Molecular Formula | C12H21N2O4D3 |
| CAS# | 1215602-82-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CCCC(COC(N)=O)(C([2H])([2H])[2H])COC(NC(C)C)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06465.html |
| Additional Information | NULL |