Salvianolic acid B
Salvianolic acid B (Sal B, Lithospermate B, Lithospermic acid B), an antioxidant and free radical scavenging compound, is the most abundant bioactive compound extracted from the root of Salvia miltiorrhiza Bunge.
| Trivial name | Sal B, Lithospermate B, Lithospermic acid B |
| Catalog Number | S4735 |
| Molecular Formula | C18H19NO7 |
| CAS# | 121521-90-2 |
| SMILES | CC1=C(C(=O)OC2=C(C(=C(C=C12)OC)O)C=O)CC(=O)N3CCOCC3 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/salvianolic-acid-b.html |
| Additional Information | https://file.selleck.cn/downloads/struct/salvianolic-acid-b-chemical-structure-s4735.gif |