WZ8040 10mM * 1mL in DMSO
WZ8040 is a novel EGFR inhibitors that suppress the growth of EGFR-T790M-containing cell lines and inhibit EGFR phosphorylation.
| Trivial name | WZ8040 10mM * 1mL in DMSO |
| Catalog Number | A10992-10mM-D |
| Alternative Name(s) | N-[3-[5-Chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
| Molecular Formula | C24H25ClN6OS |
| CAS# | 1214265-57-2 |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)SC4=CC=CC(=C4)NC(=O)C=C)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/wz8040.html |