WZ3146 10mM * 1mL in DMSO
WZ3146 is an inhibitor of EGFR receptor kinase mutants carrying a mutation in an active site gatekeeper residue (T790M) and is much less potent against wild-type EGFR kinase.
Trivial name | WZ3146 10mM * 1mL in DMSO |
Catalog Number | A10990-10mM-D |
Alternative Name(s) | N-[3-[[5-Chloro-2-[[4-(4-methyl-1-piperazinyl)phenyl]amino]-4-pyrimidinyl]oxy]phenyl]-2-propenamide |
Molecular Formula | C24H25ClN6O2 |
CAS# | 1214265-56-1 |
SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)OC4=CC=CC(=C4)NC(=O)C=C)Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/wz3146.html |