WZ3146 10mg
WZ3146 is an inhibitor of EGFR receptor kinase mutants carrying a mutation in an active site gatekeeper residue (T790M) and is much less potent against wild-type EGFR kinase.
| Trivial name | WZ3146 10mg |
| Catalog Number | A10990-10 |
| Alternative Name(s) | N-[3-[[5-Chloro-2-[[4-(4-methyl-1-piperazinyl)phenyl]amino]-4-pyrimidinyl]oxy]phenyl]-2-propenamide |
| Molecular Formula | C24H25ClN6O2 |
| CAS# | 1214265-56-1 |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)OC4=CC=CC(=C4)NC(=O)C=C)Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/wz3146.html |
