LinoleicAcid
LinoleicAcid is a group of linoleic acid isomers derived from linoleic acid and is a nutrient that is ubiquitous in humans and animals. In human food, mainly from dairy products and beef and mutton. It is contained in human serum lipids and other tissues such as adipose tissue. It reduces body fat accumulation and plays a role in lipid and glucose metabolism.
| Catalog Number | CDF4-0147 |
| Alternative Name(s) | 9,11-Octadecadienoic acid;9,11-Linoleic acid;Octadecadienoic Acid (Conjugic Acidd, cis-9,Trtans-11) (C18:2);Conjugated Linolenic Acid,CLA;Conjugated linoleic acid - Microencapsulated solid;TRANS-10,TRANS-12-OCTADECADIENOICACID;CIS-10-CIS-12-CONJUGATEDLINOLEICACID;CIS-10,CIS-12-OCTADECADIENOICACID |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C18H32O2 |
| CAS# | 121250-47-3 |
| Purity | 99.0% |
| Inchi | 1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9+ |
| SMILES | CCCCCCC=CC=CCCCCCCCC(=O)O |
| EC Number | 200-470-9 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/linoleicacid-item-2742.html |