Cefprozil hydrate 5mg
Cefprozil hydrate is a second-generation cephalosporin type antibiotic. It can be used to treat bronchitis, ear infections, skin infections, and other bacterial infections.
| Trivial name | Cefprozil hydrate 5mg |
| Catalog Number | A10190-5 |
| Alternative Name(s) | (6R,7R)-7-[[(2R)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-[(E)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate |
| Molecular Formula | C18H19N3O5S.H2O |
| CAS# | 121123-17-9 |
| SMILES | C/C=C/C1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)SC1)C(=O)O.O |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/cefprozil-hydrate-cefzil.html |
