Dabigatran 13C6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06521 |
| Alternative Name(s) | N-[[2-[[[4-(Aminoiminomethyl)phenylimidazol-5-ridinyl-b-alanine |
| Research Area | Labeled Dabigatran, intended for use as an internal standard for the quantification of Dabigatran by GC- or LC-mass spectrometry. |
| Molecular Formula | C191C6H25N7O3 |
| CAS# | 1210608-88-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN1C2=CC=C(C(N(C3=CC=CC=N3)CCC(O)=O)=O)C=C2N=C1CN[13C]4=[13CH][13CH]=[13C](C(N)=N)[13CH]=[13CH]4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06521.html |
| Additional Information | NULL |