PIM447 (LGH447)
PIM447 (LGH447) is a novel pan-PIM kinase inhibitor with Ki values of 6 pM, 18 pM, 9 pM for PIM1, PIM2, PIM3 respectively. It also inhibits GSK3β, PKN1, and PKCτ, but at a significantly lower potency with IC50 between 1 and 5 μM (>105-fold differential relative to the Ki on PIMs). PIM447 induces apoptosis.
| Trivial name | N/A |
| Catalog Number | S7985 |
| Molecular Formula | C24H23F3N4O.HCl |
| CAS# | 1210608-43-7(freebase) |
| Inchi | InChI=1S/C24H23F3N4O.ClH/c1-13-9-14(11-15(28)10-13)16-7-8-29-12-21(16)31-24(32)20-6-5-19(27)23(30-20)22-17(25)3-2-4-18(22)26;/h2-8,12-15H,9-11,28H2,1H3,(H,31,32);1H/t13-,14+,15-;/m0./s1 |
| Inchi Key | YLXJAYNSTBYEEU-HWKASLJMSA-N |
| SMILES | CC1CC(CC(C1)N)C2=C(C=NC=C2)NC(=O)C3=NC(=C(C=C3)F)C4=C(C=CC=C4F)F |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/pim447-lgh447.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s7985-pim447-lgh447-chemical-structure.gif |