Ertugliflozin L-pyroglutamic acid
Ertugliflozin (MK-8835, PF-04971729) L-pyroglutamic acid is a potent, selective and orally active inhibitor of the sodium-dependent glucose cotransporter 2 (SGLT2) with IC50 of 0.877 nM for h-SGLT2. Ertugliflozin has the potential for the treatment of type 2 diabetes mellitus.
| Trivial name | MK-8835 L-pyroglutamic acid, PF-04971729 L-pyroglutamic acid |
| Catalog Number | S4431 |
| Molecular Formula | C27H32ClNO10 |
| CAS# | 1210344-83-4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCOC1=CC=C(CC2=C(Cl)C=CC(=C2)C34OCC(CO)(O3)C(O)C(O)C4O)C=C1.OC(=O)C5CCC(=O)N5 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/ertugliflozin-l-pyroglutamic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s4431-ertugliflozin-l-pyroglutamic-acid-chemical-structure.gif |