Nelarabine (Arranon) 10mM * 1mL in DMSO
Nelarabine is a purine nucleoside analog converted to its corresponding arabinosylguanine nucleotide triphosphate (araGTP), resulting in inhibition of DNA synthesis and cytotoxicity.
Trivial name | Nelarabine (Arranon) 10mM * 1mL in DMSO |
Catalog Number | A10632-10mM-D |
Alternative Name(s) | (2R,3S,4R,5R)-2-(2-amino-6-methoxy-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
Molecular Formula | C11H15N5O5 |
CAS# | 121032-29-9 |
SMILES | COC1=NC(=NC2=C1N=CN2[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/nelarabine-arranon.html |