Sulfanilic Acid
Sulfanilic acid is a toxic metabolite of Tartrazine . Used as Ehrlich's reagent, for detecting of nitrites. Antibacterial.
| Catalog Number | CS-T-42809 |
| Alternative Name(s) | Sulfanilic acid ;Sulfamethoxazole EP Impurity D;4-Aminobenzenesulfonic Acid;4-Aminobenzenesulfonic Acid;Sulfamethoxazole EP Impurity D. |
| Research Area | Metabolites |
| Molecular Formula | C6H7NO3S |
| CAS# | 121-57-3 |
| Purity | >98% |
| SMILES | O=[S](O)(C1=CC=C(N)C=C1)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST42809.html |
