LDV-FITC | MedChemExpress (MCE)
LDV-FITC, a fluorescent peptide, is a FITC-conjugated LDV peptide (HY-P2267). LDV-FITC binds to the α4β1 integrin with high affinity (Kd: 0.3 nM and 12 nM for binding to U937 cells in the presence and absence of Mn2+ respectively). LDV-FITC can be used to detect α4β1 integrin affinity[1][2].
| Trivial name | LDV-FITC |
| Catalog Number | HY-P1188 |
| Research Area | Cancer |
| CAS# | 1207610-07-8 |
| Purity | ≥98.00% |
| SMILES | O=C([C@@H](NC([C@@H](NC([C@@H](NC([C@@H]1CCCN1C([C@@H](NC([C@@H](NC([C@H](CC(C)C)NC(CC2=CC=C(NC(NC3=CC=CC=C3C)=O)C=C2)=O)=O)CC(O)=O)=O)C(C)C)=O)=O)C)=O)C)=O)CCCCNC(NC4=CC5=C(C=C4)C6(OC5=O)C7=C(C=C(C=C7)O)OC8=C6C=CC(O)=C8)=S)O |
| PubChem Chemical Structure ID | 169450525 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ldv-fitc.html |