Anticancer agent 188 | MedChemExpress (MCE)
Anticancer agent 188 (compound D43) inhibits DNA synthesis in TNBC cells, leading to cell cycle arrest at the G2/M phase. Anticancer agent 188 has anti-cancer viability by inducing ROS-mediated apoptosis and DNA damage[1].
| Trivial name | Anticancer agent 188 |
| Catalog Number | HY-162276 |
| Research Area | Cancer |
| CAS# | 1207377-56-7 |
| Purity | ≥98.0% |
| SMILES | CN1C(C2=NC(C3=C(F)C=CC=C3)=N1)=NC(N(C)C2=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/anticancer-agent-188.html |