PKC412
PKC412 is a broad spectrum protein kinase inhibitor and inhibits conventional PKC isoforms (α, β, γ), PDFRβ, VEGFR2, Syk, PKCη, Flk-1, Flt3, Cdk1/B, PKA, c-Kit, c-Fgr, c-Src, VEGFR1 and EGFR.
| Trivial name | Midostaurin; CGP-41231 |
| Catalog Number | CSN15884 |
| Alternative Name(s) | Midostaurin; CGP-41231 |
| Research Area | Cancer |
| Molecular Formula | C35H30N4O4 |
| CAS# | 120685-11-2 |
| Purity | ≥99% |
| SMILES | C[C@@]12N3C4=C(C(CN5)=C(C6=C4N([C@]([H])(O2)C[C@H]([C@H]1OC)N(C(C7=CC=CC=C7)=O)C)C8=CC=CC=C86)C5=O)C9=CC=CC=C39 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/pkc412.html |