(RS)-PPG
group III metabotropic glutamate receptor agonist Neuroscience|GluR
| Catalog Number | B6640-5 |
| Research Area | Neuroscience|GluR |
| Molecular Formula | C8H10NO5P |
| CAS# | 120667-15-4 |
| Purity | 98% |
| SMILES | OP(O)(C(C=C1)=CC=C1NCC(O)=O)=O |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6640 |
