Zotiraciclib | MedChemExpress (MCE)
Zotiraciclib (TG02) is an orally active potent inhibitor of CDK2, JAK2 and FLT3 with IC50 values of 13, 73, and 56 nM, respectively. Zotiraciclib can be used for the research of advanced leukemias and multiple myeloma[1][2].
| Trivial name | Zotiraciclib |
| Catalog Number | HY-15163 |
| Alternative Name(s) | TG02; SB1317 |
| Research Area | Cancer |
| CAS# | 1204918-72-8 |
| Purity | ≥98.00% |
| SMILES | CN1CC2=CC(NC3=NC(C4=CC(OCC/C=C/C1)=CC=C4)=CC=N3)=CC=C2 |
| PubChem Chemical Structure ID | 16739650 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zotiraciclib.html |