Benzosceptrin C | MedChemExpress (MCE)
Benzosceptrin C is an inhibitor for PD-L1, which promotes programmed cell death ligand (PD-L1) degradation in a lysosomal pathway, enhances the cytotoxicity of T-cells and exhibits antitumor activity[1].
| Trivial name | Benzosceptrin C |
| Catalog Number | HY-N12687 |
| Research Area | Cancer |
| CAS# | 1204605-36-6 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC(Br)=C(N1)Br)NC[C@H]2C3=C(NC(N)=N4)C4=C(N=C(N5)N)C5=C3[C@@H]2CNC(C6=CC(Br)=C(N6)Br)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/benzosceptrin-c.html |