Brivaracetam D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-68547 |
| Alternative Name(s) | (aS,4R)-a-Ethyl-2-oxo-4-propyl-1-pyrrolidineacetamide-d7; UCB 34714-d7; |
| Research Area | Brivaracetam-d7, is the labeled analogue of Brivaracetam, which is a 4-n-propyl analog of levetiracetam, and a racetam derivative with anticonvulsant properties. |
| Molecular Formula | C11H13D7N2O2 |
| CAS# | 1202896-51-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C(C(N)=O)CC)C1)CC1C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST68547.html |
| Additional Information | NULL |