Clopidogrel hydrogen sulfate (Standard) | MedChemExpress (MCE)
Clopidogrel (hydrogen sulfate) (Standard) is the analytical standard of Clopidogrel (hydrogen sulfate). This product is intended for research and analytical applications. Clopidogrel hydrogen sulfate is an antiplatelet agent to prevent blood clots. Clopidogrel hydrogen sulfate inhibits CYP2B6 and CYP2C19 with IC50s of 18.2 nM and 524 nM, respectively[1]. Clopidogrel hydrogen sulfate is a potent antithrombotic agent that inhibits ADP-induced platelet aggregation[2]．Clopidogrel hydrogen sulfate also is an orally active P2Y(12) inhibitor[5].
| Trivial name | Clopidogrel hydrogen sulfate (Standard) |
| Catalog Number | HY-17459R |
| Alternative Name(s) | (S)-(+)-Clopidogrel bisulfate (Standard); (S)-(+)-Clopidogrel hydrogen sulfate (Standard) |
| Research Area | Cardiovascular Disease; Cancer |
| CAS# | 120202-66-6 |
| Purity | ≥98.0% |
| SMILES | ClC1=C([C@@H](C(OC)=O)N2CCC3=C(C=CS3)C2)C=CC=C1.O=S(O)(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/clopidogrel-hydrogen-sulfate-standard.html |