Clopidogrel 10mM * 1mL in DMSO
Clopidogrel is an oral, thienopyridine class antiplatelet agent used to inhibit blood clots in coronary artery disease, peripheral vascular disease, and cerebrovascular disease.
| Trivial name | Clopidogrel 10mM * 1mL in DMSO |
| Catalog Number | A10233-10mM-D |
| Alternative Name(s) | (+)-(S)-methyl 2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate, hydrogen sulfate salt |
| Molecular Formula | C16H16ClNO2S.H2SO4 |
| CAS# | 120202-66-6 |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/clopidogrel-plavix.html |
