MLN9708 10mM * 1mL in DMSO
MLN9708 is a proteasome inhibitor, which inhibits the activity of the proteasome, blocking the targeted proteolysis normally performed by the proteasome.
| Trivial name | MLN9708 10mM * 1mL in DMSO |
| Catalog Number | A10602-10mM-D |
| Alternative Name(s) | 4-(carboxymethyl)-2-((R)-1-(2-(2,5-dichlorobenzamido)acetamido)-3-methylbutyl)-6-oxo-1,3,2-dioxaborinane-4-carboxylic acid |
| Molecular Formula | C20H23BCl2N2O9 |
| CAS# | 1201902-80-8 |
| SMILES | B1(OC(=O)CC(O1)(CC(=O)O)C(=O)O)[C@H](CC(C)C)NC(=O)CNC(=O)C2=C(C=CC(=C2)Cl)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/mln9708.html |
