IPI-145 10mM * 1mL in DMSO
IPI-145, also known as INK-1197, is an orally bioavailable, highly selective and potent small molecule inhibitor of the delta and gamma isoforms of phosphoinositide-3 kinase (PI3K) with potential immunomodulating and antineoplastic activities.
| Trivial name | IPI-145 10mM * 1mL in DMSO |
| Catalog Number | A12422-10mM-D |
| Alternative Name(s) | (S)-3-(1-((9H-purin-6-yl)amino)ethyl)-8-chloro-2-phenylisoquinolin-1(2H)-one |
| Molecular Formula | C22H17ClN6O |
| CAS# | 1201438-56-3 |
| SMILES | C[C@@H](C1=CC2=C(C(=CC=C2)Cl)C(=O)N1C3=CC=CC=C3)NC4=NC=NC5=C4NC=N5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ipi-145.html |
