Donepezil 100mg
Donepezil is a noncompetitive acetylcholineesterase inhibitor, which can readily cross the blood brain barrier and increase the concentration of cortical acetylcholine. It is known that Donepezil is a useful tool in the study of Alzheimer’s disease.
| Trivial name | Donepezil 100mg |
| Catalog Number | A13079-100 |
| Alternative Name(s) | 2-[(1-Benzyl-4-piperidyl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| Molecular Formula | C24H29NO3 |
| CAS# | 120014-06-4 |
| SMILES | COC1=C(C=C2C(=C1)CC(C2=O)CC3CCN(CC3)CC4=CC=CC=C4)OC |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/donepezil.html |