Scoparone
Scoparone, a natural product isolated and purified from the herbs of Artemisia scoparia, with antifungal, antianginal, antioxidant, immunosuppression and vasorelaxation effects, protects against carbon tetrachloride-induced liver injury, is a very efficient inhibitor of ultraviolet radiation -induced lipid peroxidation and damage, and a phytoalexin associated with resistance of citrus to Phytophthora citrophthora.
| Trivial name | 6,7-dimethoxycoumarin; Aesculetin dimethyl ether; 6,7-Dimethylesculetin; Escoparone |
| Catalog Number | CSN16631 |
| Alternative Name(s) | 6,7-dimethoxycoumarin; Aesculetin dimethyl ether; 6,7-Dimethylesculetin; Escoparone |
| Research Area | / |
| Molecular Formula | C11H10O4 |
| CAS# | 120-08-1 |
| Purity | ≥99% |
| SMILES | O=C1C=CC2=CC(OC)=C(OC)C=C2O1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/scoparone.html |
