Delequamine | MedChemExpress (MCE)
Delequamine (RS-15385-197) is an orally active and selective α2-adrenergic receptor antagonist. Delequamine can increase the sexual behavior score of both male and female rats and can be used in the research of sexual dysfunction[1].
| Trivial name | Delequamine |
| Catalog Number | HY-106874 |
| Alternative Name(s) | RS-15385-197 |
| Research Area | Others |
| CAS# | 119905-05-4 |
| Purity | ≥98.0% |
| SMILES | CS(=O)(N1[C@@]2([H])C[C@@]3([H])C4=CC=C(OC)C=C4CCN3C[C@@]2([H])CCC1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/delequamine.html |