Uric acid sodium
Uric acid sodium (Monosodium urate) is a scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. It can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation and may have protective effects as an antioxidant in human diseases such as Parkinson’s disease and multiple sclerosis.
| Trivial name | Monosodium urate |
| Catalog Number | E7002 |
| Molecular Formula | C16H16ClN3O3S |
| CAS# | 1198-77-2 |
| Inchi | InChI=1S/C16H16ClN3O3S/c1-9-5-3-4-6-14(9)20-10(2)19-13-8-12(17)15(24(18,22)23)7-11(13)16(20)21/h3-8,10,19H,1-2H3,(H2,18,22,23) |
| Inchi Key | AQCHWTWZEMGIFD-UHFFFAOYSA-N |
| SMILES | CC1NC2=CC(=C(C=C2C(=O)N1C3=CC=CC=C3C)S(=O)(=O)N)Cl |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/uric-acid-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E7002-Uric-acid-sodium-chemical-structure.png |
