CBL0137
CBL0137 (Curaxin-137) is an inhibitor of the histone chaperone FACT (facilitates chromatin transcription) that simultaneously suppresses NF-κB and activates p53 with EC50 of 0.47 μM and 0.37 μM, respectively.
| Trivial name | Curaxin-137, CBL-C137, CBLC137 |
| Catalog Number | S0507 |
| Molecular Formula | C21H24N2O2 |
| CAS# | 1197996-80-7 |
| SMILES | CC(C)NCCN1C2=C(C=C(C=C2)C(=O)C)C3=C1C=CC(=C3)C(=O)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/cbl-0137.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0507-cbl-0137-chemical-structure.gif |