Levocarnitine Propionate HCl
Levocarnitine propionate HCl is used to treat the deterioration of renal function, congestive heart failure, intermittent claudication, and other diseases.
| Trivial name | L-Propionylcarnitine Chloride; ST-261 |
| Catalog Number | CSN12505 |
| Alternative Name(s) | L-Propionylcarnitine Chloride; ST-261 |
| Research Area | / |
| Molecular Formula | C10H20ClNO4 |
| CAS# | 119793-66-7 |
| Purity | ≥98% |
| SMILES | O=C([O-])C[C@@H](OC(CC)=O)C[N+](C)(C)C.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/levocarnitine-propionate-hcl.html |