Tranexamic acid
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02448 |
| Alternative Name(s) | Cclohexancarboxylc cid, 4-(aminomethyl)-, trans-; trans-4-(Aminomethylcclohexancarboxylc cid; AcA |
| Research Area | Tranexamic Acid is a synthetic derivative of the amino acid lysine with antifibrinolytic activity. With strong affinity for the five lysine-binding sites of plasminogen, tranexamic acid competitively inhibits the activation of plasminogen to plasmin, resu |
| Molecular Formula | C8H15NO2 |
| CAS# | 1197-18-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[13C]([C@@H]1CC[C@@H]([13CH2][15NH2])CC1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02448.html |
| Additional Information | NULL |