PRT-060318
novel Syk inhibitor Tyrosine Kinase|Spleen Tyrosine Kinase (Syk)
| Catalog Number | B6161-5 |
| Research Area | Tyrosine Kinase|Spleen Tyrosine Kinase (Syk) |
| Molecular Formula | C18H27Cl3N6O |
| CAS# | 1194961-19-7 |
| Purity | 98% |
| SMILES | O=C(C1=CN=C(N[C@H]2[C@@H](N)CCCC2)N=C1NC3=CC=CC(C)=C3)N |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6161 |
