Bimatoprost grenod
15-(6-nitroxyhexanoyl)-17-phenyl trinor Prostaglandin F2α(15-(6-nitroxyhexanoyl)-17-phenyl trinor PGF2α) is a nitric oxide-donating derivative of 17-phenyl trinor PGF2α.1It increases cGMP levels in rabbit aqueous humor and iris ciliary body when topically administered at a concentration of 0.042%. Topical administration of 15-(6-nitroxylhexanoyl)-17-phenyl trinor PGF2α(0.14%) reduces intraocular hypertension (IOP) in a rabbit model of hypertonic saline-induced transient ocular pressure. It also reduces IOP in a cynomolgus monkey model of laser-induced ocular hypertension when administered topically at a concentration of 0.042%.
| Catalog Number | T36908 |
| Alternative Name(s) | 15-(6-nitroxyhexanoyl)-17-phenyl trinor Prostaglandin F2α |
| Molecular Formula | C31H46N2O8 |
| CAS# | 1194396-71-8 |
| SMILES | CCNC(=O)CCC\C=C/C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1\C=C\[C@H](CCc1ccccc1)OC(=O)CCCCCON(=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.targetmol.com/compound/15-(6-nitroxyhexanoyl)-17-phenyl_trinor_prostaglandin_f2α |
| Additional Information | https://www.targetmol.com/datasheet/T36908 |