Loureirin B
Loureirin B (LB, LrB), a flavonoid extracted from Dracaena cochinchinensis, is an inhibitor of PAI-1 with IC50 of 26.10 μM. Loureirin B downregulates p-ERK and p-JNK in TGF-β1-stimulated fibroblasts. Loureirin B promotes insulin secretion mainly through increasing Pdx-1, MafA, intracellular ATP level, inhibiting the KATP current, influx of Ca2+ to the intracellular.
Trivial name | LB, LrB |
Catalog Number | S3242 |
Molecular Formula | C18H20O5 |
CAS# | 119425-90-0 |
SMILES | COC1=CC(=C(CCC(=O)C2=CC=C(O)C=C2)C(=C1)OC)OC |
Size | 1mg |
Supplier Page | http://www.selleckchem.com/products/loureirin-b.html |
Additional Information | https://file.selleck.cn/downloads/struct/s3242-loureirin-b-chemical-structure.gif |